D-aspartic acid


D-aspartic acid
CAS RN:[1783-96-6]
Formula:C4H7NO4; 133.10 g/mol
InChiKey:CKLJMWTZIZZHCS-UWTATZPHSA-N
SMILES:N[C@H](CC(O)=O)C(O)=O
Molecular structure of D-aspartic acid
Density:1.660 g/mL
Molar volume:80.2 mL/mol
Melting point:300 °C
Log10 partition octanol / water:-3.89

Isomers

(S)-3-aminocarbonyl-2-hydroxypropanoic acid
Molecular structure of (S)-3-aminocarbonyl-2-hydroxypropanoic acid
4-amino-2-hydroxy-4-oxobutanoic acid
Molecular structure of 4-amino-2-hydroxy-4-oxobutanoic acid
2-amino-2-methylmalonic acid
Molecular structure of 2-amino-2-methylmalonic acid
D-aspartic acid
Molecular structure of D-aspartic acid
DL-aspartic acid
Molecular structure of DL-aspartic acid
L-aspartic acid
Molecular structure of L-aspartic acid
2-(carboxymethylamino)acetic acid
Molecular structure of 2-(carboxymethylamino)acetic acid
ethyl nitroacetate
Molecular structure of ethyl nitroacetate
ethyl 2-nitroacetate
Molecular structure of ethyl 2-nitroacetate